About methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate
methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate (PubChem CID 84805976) has the molecular formula C9H13F3O3S
and a molecular weight of 258.26 g/mol. Its IUPAC name is methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate.
Analyze methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate?
The IUPAC name of methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate (CID 84805976) is methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate.
What is the SMILES notation for methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate?
The canonical SMILES for methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate is COC(=O)C1(CC(F)(F)F)CSCCC1O.
What is the InChIKey of methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate?
The InChIKey is OVIBRWPAYAKJJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O3S/c1-15-7(14)8(4-9(10,11)12)5-16-3-2-6(8)13/h6,13H,2-5H2,1H3.
What are the key properties of methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate?
methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate has a molecular weight of 258.26 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-3-(2,2,2-trifluoroethyl)thiane-3-carboxylate is sourced from PubChem (CID 84805976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).