About [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine
[4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine (PubChem CID 84806283) has the molecular formula C11H14ClNO2S
and a molecular weight of 259.76 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine |
| PubChem CID | 84806283 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine |
| SMILES | NCC1CS(=O)(=O)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO2S/c12-10-3-1-8(2-4-10)11-7-16(14,15)6-9(11)5-13/h1-4,9,11H,5-7,13H2 |
| InChIKey | GAXSWHOXXBPASI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine?
The IUPAC name of [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine (CID 84806283) is [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine.
What is the SMILES notation for [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine?
The canonical SMILES for [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine is NCC1CS(=O)(=O)CC1c1ccc(Cl)cc1.
What is the InChIKey of [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine?
The InChIKey is GAXSWHOXXBPASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO2S/c12-10-3-1-8(2-4-10)11-7-16(14,15)6-9(11)5-13/h1-4,9,11H,5-7,13H2.
What are the key properties of [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine?
[4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine has a molecular weight of 259.76 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)-1,1-dioxothiolan-3-yl]methanamine is sourced from PubChem (CID 84806283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).