C12H18F2O2S — CID 84807408
4-(cyclopentylmethyl)-3,3-difluorothiane-4-carboxylic acid (PubChem CID 84807408) has the molecular formula C12H18F2O2S and a molecular weight of 264.34 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-3,3-difluorothiane-4-carboxylic acid.
| Compound Name | 4-(cyclopentylmethyl)-3,3-difluorothiane-4-carboxylic acid |
|---|---|
| PubChem CID | 84807408 |
| Molecular Formula | C12H18F2O2S |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-(cyclopentylmethyl)-3,3-difluorothiane-4-carboxylic acid |
| SMILES | O=C(O)C1(CC2CCCC2)CCSCC1(F)F |
| InChI | InChI=1S/C12H18F2O2S/c13-12(14)8-17-6-5-11(12,10(15)16)7-9-3-1-2-4-9/h9H,1-8H2,(H,15,16) |
| InChIKey | NIVAOIHXBAEWHK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |