C10H9BrN2S — CID 84808579
2-bromo-4-(4-methylphenyl)-1,3-thiazol-5-amine (PubChem CID 84808579) has the molecular formula C10H9BrN2S and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-bromo-4-(4-methylphenyl)-1,3-thiazol-5-amine.
| Compound Name | 2-bromo-4-(4-methylphenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 84808579 |
| Molecular Formula | C10H9BrN2S |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-bromo-4-(4-methylphenyl)-1,3-thiazol-5-amine |
| SMILES | Cc1ccc(-c2nc(Br)sc2N)cc1 |
| InChI | InChI=1S/C10H9BrN2S/c1-6-2-4-7(5-3-6)8-9(12)14-10(11)13-8/h2-5H,12H2,1H3 |
| InChIKey | IQKIPMQTZWPDKT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |