C10H6F3N5O — CID 84808612
6-(1-isocyanatocyclopropyl)-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 84808612) has the molecular formula C10H6F3N5O and a molecular weight of 269.19 g/mol. Its IUPAC name is 6-(1-isocyanatocyclopropyl)-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 6-(1-isocyanatocyclopropyl)-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 84808612 |
| Molecular Formula | C10H6F3N5O |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 6-(1-isocyanatocyclopropyl)-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | O=C=NC1(c2cnc3nc(C(F)(F)F)nn3c2)CC1 |
| InChI | InChI=1S/C10H6F3N5O/c11-10(12,13)7-16-8-14-3-6(4-18(8)17-7)9(1-2-9)15-5-19/h3-4H,1-2H2 |
| InChIKey | XKTGUDBVFOBBRX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|