About 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine
2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine (PubChem CID 84809035) has the molecular formula C12H16BrNO
and a molecular weight of 270.17 g/mol. Its IUPAC name is 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine.
Molecular Properties
| Compound Name | 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine |
| PubChem CID | 84809035 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine |
| SMILES | CC1Cc2cc(C(C)(C)N)cc(Br)c2O1 |
| InChI | InChI=1S/C12H16BrNO/c1-7-4-8-5-9(12(2,3)14)6-10(13)11(8)15-7/h5-7H,4,14H2,1-3H3 |
| InChIKey | VAQSBJHRJSYQIQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine?
The IUPAC name of 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine (CID 84809035) is 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine.
What is the SMILES notation for 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine?
The canonical SMILES for 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine is CC1Cc2cc(C(C)(C)N)cc(Br)c2O1.
What is the InChIKey of 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine?
The InChIKey is VAQSBJHRJSYQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO/c1-7-4-8-5-9(12(2,3)14)6-10(13)11(8)15-7/h5-7H,4,14H2,1-3H3.
What are the key properties of 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine?
2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine has a molecular weight of 270.17 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine is sourced from PubChem (CID 84809035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).