About 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene
1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene (PubChem CID 84810772) has the molecular formula C10H8BrF2NO
and a molecular weight of 276.08 g/mol. Its IUPAC name is 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene |
| PubChem CID | 84810772 |
| Molecular Formula | C10H8BrF2NO |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene |
| SMILES | O=C=NCCC(F)(F)c1ccccc1Br |
| InChI | InChI=1S/C10H8BrF2NO/c11-9-4-2-1-3-8(9)10(12,13)5-6-14-7-15/h1-4H,5-6H2 |
| InChIKey | WURDEZKXHSKNGB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene?
The IUPAC name of 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene (CID 84810772) is 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene.
What is the SMILES notation for 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene?
The canonical SMILES for 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene is O=C=NCCC(F)(F)c1ccccc1Br.
What is the InChIKey of 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene?
The InChIKey is WURDEZKXHSKNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF2NO/c11-9-4-2-1-3-8(9)10(12,13)5-6-14-7-15/h1-4H,5-6H2.
What are the key properties of 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene?
1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene has a molecular weight of 276.08 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(1,1-difluoro-3-isocyanatopropyl)benzene is sourced from PubChem (CID 84810772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).