About 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one
3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one (PubChem CID 84815001) has the molecular formula C14H16N2O3S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one.
Molecular Properties
| Compound Name | 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one |
| PubChem CID | 84815001 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one |
| SMILES | NC1(c2ccccc2N2CC3CC(C2=O)S3(=O)=O)CC1 |
| InChI | InChI=1S/C14H16N2O3S/c15-14(5-6-14)10-3-1-2-4-11(10)16-8-9-7-12(13(16)17)20(9,18)19/h1-4,9,12H,5-8,15H2 |
| InChIKey | VWWVHWQDKDCUJP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one?
The IUPAC name of 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one (CID 84815001) is 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one.
What is the SMILES notation for 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one?
The canonical SMILES for 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one is NC1(c2ccccc2N2CC3CC(C2=O)S3(=O)=O)CC1.
What is the InChIKey of 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one?
The InChIKey is VWWVHWQDKDCUJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3S/c15-14(5-6-14)10-3-1-2-4-11(10)16-8-9-7-12(13(16)17)20(9,18)19/h1-4,9,12H,5-8,15H2.
What are the key properties of 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one?
3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one has a molecular weight of 292.36 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1-aminocyclopropyl)phenyl]-6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-2-one is sourced from PubChem (CID 84815001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).