About 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one
5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one (PubChem CID 84815354) has the molecular formula C14H18N2O3S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one.
Molecular Properties
| Compound Name | 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one |
| PubChem CID | 84815354 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one |
| SMILES | NCCc1cccc(CN2C(=O)C3CC2CS3(=O)=O)c1 |
| InChI | InChI=1S/C14H18N2O3S/c15-5-4-10-2-1-3-11(6-10)8-16-12-7-13(14(16)17)20(18,19)9-12/h1-3,6,12-13H,4-5,7-9,15H2 |
| InChIKey | CXQZABAHJLWJKN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one?
The IUPAC name of 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one (CID 84815354) is 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one.
What is the SMILES notation for 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one?
The canonical SMILES for 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one is NCCc1cccc(CN2C(=O)C3CC2CS3(=O)=O)c1.
What is the InChIKey of 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one?
The InChIKey is CXQZABAHJLWJKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S/c15-5-4-10-2-1-3-11(6-10)8-16-12-7-13(14(16)17)20(18,19)9-12/h1-3,6,12-13H,4-5,7-9,15H2.
What are the key properties of 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one?
5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one has a molecular weight of 294.38 g/mol, XLogP of 0.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-(2-aminoethyl)phenyl]methyl]-2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-6-one is sourced from PubChem (CID 84815354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).