C14H23N3O2S — CID 84815843
N-methyl-3-[6-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-2-yl]propan-1-amine (PubChem CID 84815843) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-methyl-3-[6-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[6-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 84815843 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-methyl-3-[6-(4-methylphenyl)-1,1-dioxo-1,2,6-thiadiazinan-2-yl]propan-1-amine |
| SMILES | CNCCCN1CCCN(c2ccc(C)cc2)S1(=O)=O |
| InChI | InChI=1S/C14H23N3O2S/c1-13-5-7-14(8-6-13)17-12-4-11-16(20(17,18)19)10-3-9-15-2/h5-8,15H,3-4,9-12H2,1-2H3 |
| InChIKey | SYAUPPDLRBRXJL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|