C12H14N2O4 — CID 84816458
2-[[cyano-(3-ethoxy-2-hydroxyphenyl)methyl]amino]acetic acid (PubChem CID 84816458) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-[[cyano-(3-ethoxy-2-hydroxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[[cyano-(3-ethoxy-2-hydroxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 84816458 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[[cyano-(3-ethoxy-2-hydroxyphenyl)methyl]amino]acetic acid |
| SMILES | CCOc1cccc(C(C#N)NCC(=O)O)c1O |
| InChI | InChI=1S/C12H14N2O4/c1-2-18-10-5-3-4-8(12(10)17)9(6-13)14-7-11(15)16/h3-5,9,14,17H,2,7H2,1H3,(H,15,16) |
| InChIKey | CRPQTLIXRHJFSY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|