C11H17N3OS — CID 84816767
1-[3-(3-aminophenoxy)propyl]-3-methylthiourea (PubChem CID 84816767) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-[3-(3-aminophenoxy)propyl]-3-methylthiourea.
| Compound Name | 1-[3-(3-aminophenoxy)propyl]-3-methylthiourea |
|---|---|
| PubChem CID | 84816767 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-[3-(3-aminophenoxy)propyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCCOc1cccc(N)c1 |
| InChI | InChI=1S/C11H17N3OS/c1-13-11(16)14-6-3-7-15-10-5-2-4-9(12)8-10/h2,4-5,8H,3,6-7,12H2,1H3,(H2,13,14,16) |
| InChIKey | SHHNOIZOPQCDDM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|