C10H10F3NO3 — CID 84816936
2-(4-aminophenoxy)ethyl 2,2,2-trifluoroacetate (PubChem CID 84816936) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 2-(4-aminophenoxy)ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-(4-aminophenoxy)ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 84816936 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-(4-aminophenoxy)ethyl 2,2,2-trifluoroacetate |
| SMILES | Nc1ccc(OCCOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO3/c11-10(12,13)9(15)17-6-5-16-8-3-1-7(14)2-4-8/h1-4H,5-6,14H2 |
| InChIKey | BNRPLNXBXFVHRK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|