3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid

C12H12N2O4S — CID 84818185

IUPAC3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid
SMILESCCN1C(=O)SC(Nc2cccc(C(=O)O)c2)C1=O
InChIInChI=1S/C12H12N2O4S/c1-2-14-10(15)9(19-12(14)18)13-8-5-3-4-7(6-8)11(16)17/h3-6,9,13H,2H2,1H3,(H,16,17)
InChIKeyHTHFTGGAHMYESR-UHFFFAOYSA-N
MW280.31 g/mol
LogP1.84
Rot. Bonds4

About 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid

3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid (PubChem CID 84818185) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid.

Molecular Properties

Compound Name3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid
PubChem CID84818185
Molecular FormulaC12H12N2O4S
Molecular Weight280.31 g/mol
Exact Mass280.05
IUPAC Name3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid
SMILESCCN1C(=O)SC(Nc2cccc(C(=O)O)c2)C1=O
InChIInChI=1S/C12H12N2O4S/c1-2-14-10(15)9(19-12(14)18)13-8-5-3-4-7(6-8)11(16)17/h3-6,9,13H,2H2,1H3,(H,16,17)
InChIKeyHTHFTGGAHMYESR-UHFFFAOYSA-N
XLogP1.84
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.31
LogP ≤ 51.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid?
The IUPAC name of 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid (CID 84818185) is 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid.
What is the SMILES notation for 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid?
The canonical SMILES for 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid is CCN1C(=O)SC(Nc2cccc(C(=O)O)c2)C1=O.
What is the InChIKey of 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid?
The InChIKey is HTHFTGGAHMYESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S/c1-2-14-10(15)9(19-12(14)18)13-8-5-3-4-7(6-8)11(16)17/h3-6,9,13H,2H2,1H3,(H,16,17).
What are the key properties of 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid?
3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid has a molecular weight of 280.31 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoic acid is sourced from PubChem (CID 84818185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).