C10H6Cl2N2O3 — CID 84818319
2-(2,5-dichlorophenyl)-5-oxo-1H-pyrazole-4-carboxylic acid (PubChem CID 84818319) has the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-5-oxo-1H-pyrazole-4-carboxylic acid.
| Compound Name | 2-(2,5-dichlorophenyl)-5-oxo-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 84818319 |
| Molecular Formula | C10H6Cl2N2O3 |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-5-oxo-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2cc(Cl)ccc2Cl)[nH]c1=O |
| InChI | InChI=1S/C10H6Cl2N2O3/c11-5-1-2-7(12)8(3-5)14-4-6(10(16)17)9(15)13-14/h1-4H,(H,13,15)(H,16,17) |
| InChIKey | DPBNRFBRYZSEKF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |