C13H13N3O3 — CID 84818373
methyl (E)-3-[2-(methylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate (PubChem CID 84818373) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is methyl (E)-3-[2-(methylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-(methylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 84818373 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | methyl (E)-3-[2-(methylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
| SMILES | CNc1nc2ccccn2c(=O)c1/C=C/C(=O)OC |
| InChI | InChI=1S/C13H13N3O3/c1-14-12-9(6-7-11(17)19-2)13(18)16-8-4-3-5-10(16)15-12/h3-8,14H,1-2H3/b7-6+ |
| InChIKey | NDTFKWDCQXLISY-VOTSOKGWSA-N |
| XLogP | 0.92 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|