C25H30N4O3S — CID 84818807
5-[1-(2-morpholin-4-ylethyl)-2-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-4-ylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 84818807) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is 5-[1-(2-morpholin-4-ylethyl)-2-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-4-ylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[1-(2-morpholin-4-ylethyl)-2-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-4-ylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 84818807 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 5-[1-(2-morpholin-4-ylethyl)-2-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-4-ylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=C1C=C(c2ccccc2)N(CCN2CCOCC2)C2CCCCC12 |
| InChI | InChI=1S/C25H30N4O3S/c30-23-22(24(31)27-25(33)26-23)19-16-21(17-6-2-1-3-7-17)29(20-9-5-4-8-18(19)20)11-10-28-12-14-32-15-13-28/h1-3,6-7,16,18,20H,4-5,8-15H2,(H2,26,27,30,31,33) |
| InChIKey | QXGPZMFKSMMFLJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|