About 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride
2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride (PubChem CID 84819293) has the molecular formula C9H12ClNO3
and a molecular weight of 217.65 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride |
| PubChem CID | 84819293 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride |
| SMILES | Cl.NC1Oc2ccc(CCO)cc2O1 |
| InChI | InChI=1S/C9H11NO3.ClH/c10-9-12-7-2-1-6(3-4-11)5-8(7)13-9;/h1-2,5,9,11H,3-4,10H2;1H |
| InChIKey | FXSJEZLKVMURLZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride?
The IUPAC name of 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride (CID 84819293) is 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride.
What is the SMILES notation for 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride?
The canonical SMILES for 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride is Cl.NC1Oc2ccc(CCO)cc2O1.
What is the InChIKey of 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride?
The InChIKey is FXSJEZLKVMURLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3.ClH/c10-9-12-7-2-1-6(3-4-11)5-8(7)13-9;/h1-2,5,9,11H,3-4,10H2;1H.
What are the key properties of 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride?
2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride has a molecular weight of 217.65 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-benzodioxol-5-yl)ethanol;hydrochloride is sourced from PubChem (CID 84819293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).