C35H39F3N2O2SSi — CID 84819712
2,4,6-tri(propan-2-yl)-N-[(E)-(2,2,2-trifluoro-1-triphenylsilylethylidene)amino]benzenesulfonamide (PubChem CID 84819712) has the molecular formula C35H39F3N2O2SSi and a molecular weight of 636.86 g/mol. Its IUPAC name is 2,4,6-tri(propan-2-yl)-N-[(E)-(2,2,2-trifluoro-1-triphenylsilylethylidene)amino]benzenesulfonamide.
| Compound Name | 2,4,6-tri(propan-2-yl)-N-[(E)-(2,2,2-trifluoro-1-triphenylsilylethylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 84819712 |
| Molecular Formula | C35H39F3N2O2SSi |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | 2,4,6-tri(propan-2-yl)-N-[(E)-(2,2,2-trifluoro-1-triphenylsilylethylidene)amino]benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N/N=C(\C(F)(F)F)[Si](c2ccccc2)(c2ccccc2)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C35H39F3N2O2SSi/c1-24(2)27-22-31(25(3)4)33(32(23-27)26(5)6)43(41,42)40-39-34(35(36,37)38)44(28-16-10-7-11-17-28,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-26,40H,1-6H3/b39-34+ |
| InChIKey | GVOIPDXOCSEXRH-JQJRJOTLSA-N |
| XLogP | 6.96 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|