About 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride
5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride (PubChem CID 84819848) has the molecular formula C9H10ClNO4
and a molecular weight of 231.63 g/mol. Its IUPAC name is 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride |
| PubChem CID | 84819848 |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride |
| SMILES | Cl.Nc1ccc(C(=O)O)c2c1OCCO2 |
| InChI | InChI=1S/C9H9NO4.ClH/c10-6-2-1-5(9(11)12)7-8(6)14-4-3-13-7;/h1-2H,3-4,10H2,(H,11,12);1H |
| InChIKey | HDVOJJZIQXGNQC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride?
The IUPAC name of 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride (CID 84819848) is 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride.
What is the SMILES notation for 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride?
The canonical SMILES for 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride is Cl.Nc1ccc(C(=O)O)c2c1OCCO2.
What is the InChIKey of 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride?
The InChIKey is HDVOJJZIQXGNQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4.ClH/c10-6-2-1-5(9(11)12)7-8(6)14-4-3-13-7;/h1-2H,3-4,10H2,(H,11,12);1H.
What are the key properties of 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride?
5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride has a molecular weight of 231.63 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dihydro-1,4-benzodioxine-8-carboxylic acid;hydrochloride is sourced from PubChem (CID 84819848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).