C7H5Cl2N3 — CID 84819877
3,5-dichloro-6-ethylpyrazine-2-carbonitrile (PubChem CID 84819877) has the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. Its IUPAC name is 3,5-dichloro-6-ethylpyrazine-2-carbonitrile.
| Compound Name | 3,5-dichloro-6-ethylpyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 84819877 |
| Molecular Formula | C7H5Cl2N3 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 3,5-dichloro-6-ethylpyrazine-2-carbonitrile |
| SMILES | CCc1nc(C#N)c(Cl)nc1Cl |
| InChI | InChI=1S/C7H5Cl2N3/c1-2-4-6(8)12-7(9)5(3-10)11-4/h2H2,1H3 |
| InChIKey | BOMIYODDZMTKBX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |