About 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole
3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole (PubChem CID 84819945) has the molecular formula C16H11F4N
and a molecular weight of 293.26 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole.
Molecular Properties
| Compound Name | 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole |
| PubChem CID | 84819945 |
| Molecular Formula | C16H11F4N |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole |
| SMILES | Fc1ccccc1-c1cn(CC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C16H11F4N/c17-14-7-3-1-5-11(14)13-9-21(10-16(18,19)20)15-8-4-2-6-12(13)15/h1-9H,10H2 |
| InChIKey | JNLRAKFXCFUSDW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole?
The IUPAC name of 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole (CID 84819945) is 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole.
What is the SMILES notation for 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole?
The canonical SMILES for 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole is Fc1ccccc1-c1cn(CC(F)(F)F)c2ccccc12.
What is the InChIKey of 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole?
The InChIKey is JNLRAKFXCFUSDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F4N/c17-14-7-3-1-5-11(14)13-9-21(10-16(18,19)20)15-8-4-2-6-12(13)15/h1-9H,10H2.
What are the key properties of 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole?
3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole has a molecular weight of 293.26 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)indole is sourced from PubChem (CID 84819945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).