C18H28ClRu — CID 84820140
chlororuthenium;(1Z,5Z)-cycloocta-1,5-diene;1,2,3,5,5-pentamethylcyclopenta-1,3-diene (PubChem CID 84820140) has the molecular formula C18H28ClRu and a molecular weight of 380.95 g/mol. Its IUPAC name is chlororuthenium;(1Z,5Z)-cycloocta-1,5-diene;1,2,3,5,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | chlororuthenium;(1Z,5Z)-cycloocta-1,5-diene;1,2,3,5,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 84820140 |
| Molecular Formula | C18H28ClRu |
| Molecular Weight | 380.95 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | chlororuthenium;(1Z,5Z)-cycloocta-1,5-diene;1,2,3,5,5-pentamethylcyclopenta-1,3-diene |
| SMILES | C1=C\CC/C=C\CC/1.CC1=CC(C)(C)C(C)=C1C.Cl[Ru] |
| InChI | InChI=1S/C10H16.C8H12.ClH.Ru/c1-7-6-10(4,5)9(3)8(7)2;1-2-4-6-8-7-5-3-1;;/h6H,1-5H3;1-2,7-8H,3-6H2;1H;/q;;;+1/p-1/b;2-1-,8-7-;; |
| InChIKey | JBVMVFXUVNUNNG-ONEVTFJLSA-M |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.95 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|