About 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine
5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine (PubChem CID 84820365) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine.
Molecular Properties
| Compound Name | 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine |
| PubChem CID | 84820365 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine |
| SMILES | CC(C)=CCCC1(C)C=COCCO1 |
| InChI | InChI=1S/C12H20O2/c1-11(2)5-4-6-12(3)7-8-13-9-10-14-12/h5,7-8H,4,6,9-10H2,1-3H3 |
| InChIKey | XVEYQIUELHMIIR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine?
The IUPAC name of 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine (CID 84820365) is 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine.
What is the SMILES notation for 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine?
The canonical SMILES for 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine is CC(C)=CCCC1(C)C=COCCO1.
What is the InChIKey of 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine?
The InChIKey is XVEYQIUELHMIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-11(2)5-4-6-12(3)7-8-13-9-10-14-12/h5,7-8H,4,6,9-10H2,1-3H3.
What are the key properties of 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine?
5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine has a molecular weight of 196.29 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-(4-methylpent-3-enyl)-2,3-dihydro-1,4-dioxepine is sourced from PubChem (CID 84820365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).