C11H11F3N2O4 — CID 84820489
N-(4,6-dimethoxy-2-pyridinyl)-4,4,4-trifluoro-3-oxobutanamide (PubChem CID 84820489) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is N-(4,6-dimethoxy-2-pyridinyl)-4,4,4-trifluoro-3-oxobutanamide.
| Compound Name | N-(4,6-dimethoxy-2-pyridinyl)-4,4,4-trifluoro-3-oxobutanamide |
|---|---|
| PubChem CID | 84820489 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-(4,6-dimethoxy-2-pyridinyl)-4,4,4-trifluoro-3-oxobutanamide |
| SMILES | COc1cc(NC(=O)CC(=O)C(F)(F)F)nc(OC)c1 |
| InChI | InChI=1S/C11H11F3N2O4/c1-19-6-3-8(16-10(4-6)20-2)15-9(18)5-7(17)11(12,13)14/h3-4H,5H2,1-2H3,(H,15,16,18) |
| InChIKey | UVIPCTSKGPKTGE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|