About 1-methyl-3,3-bis(trifluoromethyl)cyclohexene
1-methyl-3,3-bis(trifluoromethyl)cyclohexene (PubChem CID 84820758) has the molecular formula C9H10F6
and a molecular weight of 232.17 g/mol. Its IUPAC name is 1-methyl-3,3-bis(trifluoromethyl)cyclohexene.
Molecular Properties
| Compound Name | 1-methyl-3,3-bis(trifluoromethyl)cyclohexene |
| PubChem CID | 84820758 |
| Molecular Formula | C9H10F6 |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-methyl-3,3-bis(trifluoromethyl)cyclohexene |
| SMILES | CC1=CC(C(F)(F)F)(C(F)(F)F)CCC1 |
| InChI | InChI=1S/C9H10F6/c1-6-3-2-4-7(5-6,8(10,11)12)9(13,14)15/h5H,2-4H2,1H3 |
| InChIKey | VJXOKVVSXAHCPK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3,3-bis(trifluoromethyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,3-bis(trifluoromethyl)cyclohexene?
The IUPAC name of 1-methyl-3,3-bis(trifluoromethyl)cyclohexene (CID 84820758) is 1-methyl-3,3-bis(trifluoromethyl)cyclohexene.
What is the SMILES notation for 1-methyl-3,3-bis(trifluoromethyl)cyclohexene?
The canonical SMILES for 1-methyl-3,3-bis(trifluoromethyl)cyclohexene is CC1=CC(C(F)(F)F)(C(F)(F)F)CCC1.
What is the InChIKey of 1-methyl-3,3-bis(trifluoromethyl)cyclohexene?
The InChIKey is VJXOKVVSXAHCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F6/c1-6-3-2-4-7(5-6,8(10,11)12)9(13,14)15/h5H,2-4H2,1H3.
What are the key properties of 1-methyl-3,3-bis(trifluoromethyl)cyclohexene?
1-methyl-3,3-bis(trifluoromethyl)cyclohexene has a molecular weight of 232.17 g/mol, XLogP of 4.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,3-bis(trifluoromethyl)cyclohexene is sourced from PubChem (CID 84820758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).