About 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione
2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione (PubChem CID 84820894) has the molecular formula C15H13N3O4
and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione |
| PubChem CID | 84820894 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione |
| SMILES | CCCn1c(N2C(=O)c3ccccc3C2=O)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H13N3O4/c1-2-7-17-12(8-11(19)16-15(17)22)18-13(20)9-5-3-4-6-10(9)14(18)21/h3-6,8H,2,7H2,1H3,(H,16,19,22) |
| InChIKey | QVWAYFXXKLWBHB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione?
The IUPAC name of 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione (CID 84820894) is 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione.
What is the SMILES notation for 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione?
The canonical SMILES for 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione is CCCn1c(N2C(=O)c3ccccc3C2=O)cc(=O)[nH]c1=O.
What is the InChIKey of 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione?
The InChIKey is QVWAYFXXKLWBHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O4/c1-2-7-17-12(8-11(19)16-15(17)22)18-13(20)9-5-3-4-6-10(9)14(18)21/h3-6,8H,2,7H2,1H3,(H,16,19,22).
What are the key properties of 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione?
2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione has a molecular weight of 299.29 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dioxo-3-propylpyrimidin-4-yl)isoindole-1,3-dione is sourced from PubChem (CID 84820894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).