C16H23NO5S — CID 848330
ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 848330) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 848330 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | ethyl 1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C16H23NO5S/c1-3-21-14-5-7-15(8-6-14)23(19,20)17-11-9-13(10-12-17)16(18)22-4-2/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey | CSZRHOWJGWFSCK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |