About 3,5-dimethyl-1,3-benzoxazole-2-thione
3,5-dimethyl-1,3-benzoxazole-2-thione (PubChem CID 848529) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,3-benzoxazole-2-thione |
| PubChem CID | 848529 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 3,5-dimethyl-1,3-benzoxazole-2-thione |
| SMILES | Cc1ccc2oc(=S)n(C)c2c1 |
| InChI | InChI=1S/C9H9NOS/c1-6-3-4-8-7(5-6)10(2)9(12)11-8/h3-5H,1-2H3 |
| InChIKey | WJRBNMRCNVIWFB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,3-benzoxazole-2-thione?
The IUPAC name of 3,5-dimethyl-1,3-benzoxazole-2-thione (CID 848529) is 3,5-dimethyl-1,3-benzoxazole-2-thione.
What is the SMILES notation for 3,5-dimethyl-1,3-benzoxazole-2-thione?
The canonical SMILES for 3,5-dimethyl-1,3-benzoxazole-2-thione is Cc1ccc2oc(=S)n(C)c2c1.
What is the InChIKey of 3,5-dimethyl-1,3-benzoxazole-2-thione?
The InChIKey is WJRBNMRCNVIWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-6-3-4-8-7(5-6)10(2)9(12)11-8/h3-5H,1-2H3.
What are the key properties of 3,5-dimethyl-1,3-benzoxazole-2-thione?
3,5-dimethyl-1,3-benzoxazole-2-thione has a molecular weight of 179.24 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,3-benzoxazole-2-thione is sourced from PubChem (CID 848529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).