C8H6FN3S — CID 848588
5-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 848588) has the molecular formula C8H6FN3S and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 848588 |
| Molecular Formula | C8H6FN3S |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 5-(3-fluorophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C8H6FN3S/c9-6-3-1-2-5(4-6)7-11-12-8(10)13-7/h1-4H,(H2,10,12) |
| InChIKey | HIUFXEMEPWWSHH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |