C25H23N3O3 — CID 84861647
N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3,3-diphenylpropanamide (PubChem CID 84861647) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3,3-diphenylpropanamide.
| Compound Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 84861647 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-3,3-diphenylpropanamide |
| SMILES | CC1(c2ccccc2)NC(=O)N(NC(=O)CC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C25H23N3O3/c1-25(20-15-9-4-10-16-20)23(30)28(24(31)26-25)27-22(29)17-21(18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16,21H,17H2,1H3,(H,26,31)(H,27,29) |
| InChIKey | BTEKPFRZQYIBQI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|