C16H12N4S — CID 848738
3-benzyl-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 848738) has the molecular formula C16H12N4S and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-benzyl-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-benzyl-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 848738 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-benzyl-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | c1ccc(Cc2nnc3sc(-c4ccccc4)nn23)cc1 |
| InChI | InChI=1S/C16H12N4S/c1-3-7-12(8-4-1)11-14-17-18-16-20(14)19-15(21-16)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | AORWHAJFRSFJFP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |