About 4-(4-chlorophenyl)thiane
4-(4-chlorophenyl)thiane (PubChem CID 848879) has the molecular formula C11H13ClS
and a molecular weight of 212.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)thiane.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)thiane |
| PubChem CID | 848879 |
| Molecular Formula | C11H13ClS |
| Molecular Weight | 212.75 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-(4-chlorophenyl)thiane |
| SMILES | Clc1ccc(C2CCSCC2)cc1 |
| InChI | InChI=1S/C11H13ClS/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-4,10H,5-8H2 |
| InChIKey | WROVLOOOXFUDMO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-chlorophenyl)thiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)thiane?
The IUPAC name of 4-(4-chlorophenyl)thiane (CID 848879) is 4-(4-chlorophenyl)thiane.
What is the SMILES notation for 4-(4-chlorophenyl)thiane?
The canonical SMILES for 4-(4-chlorophenyl)thiane is Clc1ccc(C2CCSCC2)cc1.
What is the InChIKey of 4-(4-chlorophenyl)thiane?
The InChIKey is WROVLOOOXFUDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClS/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-4,10H,5-8H2.
What are the key properties of 4-(4-chlorophenyl)thiane?
4-(4-chlorophenyl)thiane has a molecular weight of 212.75 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)thiane is sourced from PubChem (CID 848879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).