C19H22N2S — CID 848890
3-N-cyclopentyl-1-N-phenyl-4,5,6,7-tetrahydro-2-benzothiophene-1,3-diimine (PubChem CID 848890) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 3-N-cyclopentyl-1-N-phenyl-4,5,6,7-tetrahydro-2-benzothiophene-1,3-diimine.
| Compound Name | 3-N-cyclopentyl-1-N-phenyl-4,5,6,7-tetrahydro-2-benzothiophene-1,3-diimine |
|---|---|
| PubChem CID | 848890 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-N-cyclopentyl-1-N-phenyl-4,5,6,7-tetrahydro-2-benzothiophene-1,3-diimine |
| SMILES | c1ccc(/N=C2\S/C(=N\C3CCCC3)C3=C2CCCC3)cc1 |
| InChI | InChI=1S/C19H22N2S/c1-2-8-14(9-3-1)20-18-16-12-6-7-13-17(16)19(22-18)21-15-10-4-5-11-15/h1-3,8-9,15H,4-7,10-13H2/b20-18-,21-19- |
| InChIKey | IXUZGNMUJYCDGP-AUYXYSRISA-N |
| XLogP | 5.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|