About 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine
4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine (PubChem CID 848993) has the molecular formula C17H18ClN5O
and a molecular weight of 343.82 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine |
| PubChem CID | 848993 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine |
| SMILES | Cc1nnc(N2CCOCC2)c2nn(-c3cccc(Cl)c3)c(C)c12 |
| InChI | InChI=1S/C17H18ClN5O/c1-11-15-12(2)23(14-5-3-4-13(18)10-14)21-16(15)17(20-19-11)22-6-8-24-9-7-22/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | DEQYZHCKVATCCF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine?
The IUPAC name of 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine (CID 848993) is 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine.
What is the SMILES notation for 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine?
The canonical SMILES for 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine is Cc1nnc(N2CCOCC2)c2nn(-c3cccc(Cl)c3)c(C)c12.
What is the InChIKey of 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine?
The InChIKey is DEQYZHCKVATCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN5O/c1-11-15-12(2)23(14-5-3-4-13(18)10-14)21-16(15)17(20-19-11)22-6-8-24-9-7-22/h3-5,10H,6-9H2,1-2H3.
What are the key properties of 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine?
4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine has a molecular weight of 343.82 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3-chlorophenyl)-3,4-dimethylpyrazolo[3,4-d]pyridazin-7-yl]morpholine is sourced from PubChem (CID 848993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).