About piperidine-2-carboxylic acid
piperidine-2-carboxylic acid (PubChem CID 849) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is piperidine-2-carboxylic acid.
Molecular Properties
| Compound Name | piperidine-2-carboxylic acid |
| PubChem CID | 849 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1 |
| InChI | InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9) |
| InChIKey | HXEACLLIILLPRG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-2-carboxylic acid?
The IUPAC name of piperidine-2-carboxylic acid (CID 849) is piperidine-2-carboxylic acid.
What is the SMILES notation for piperidine-2-carboxylic acid?
The canonical SMILES for piperidine-2-carboxylic acid is O=C(O)C1CCCCN1.
What is the InChIKey of piperidine-2-carboxylic acid?
The InChIKey is HXEACLLIILLPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9).
What are the key properties of piperidine-2-carboxylic acid?
piperidine-2-carboxylic acid has a molecular weight of 129.16 g/mol, XLogP of 0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-2-carboxylic acid is sourced from PubChem (CID 849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).