C18H20ClNO3S — CID 84919661
N-(4-chloro-2-methoxy-5-methylphenyl)-2-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 84919661) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 84919661 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(SC(C)C(=O)Nc2cc(C)c(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C18H20ClNO3S/c1-11-9-16(17(23-4)10-15(11)19)20-18(21)12(2)24-14-7-5-13(22-3)6-8-14/h5-10,12H,1-4H3,(H,20,21) |
| InChIKey | BNXPQWXRYCLKNJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |