About 5-chloro-1,4-diphenyltriazole
5-chloro-1,4-diphenyltriazole (PubChem CID 849380) has the molecular formula C14H10ClN3
and a molecular weight of 255.71 g/mol. Its IUPAC name is 5-chloro-1,4-diphenyltriazole.
Molecular Properties
| Compound Name | 5-chloro-1,4-diphenyltriazole |
| PubChem CID | 849380 |
| Molecular Formula | C14H10ClN3 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-chloro-1,4-diphenyltriazole |
| SMILES | Clc1c(-c2ccccc2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C14H10ClN3/c15-14-13(11-7-3-1-4-8-11)16-17-18(14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | JROKPQGOVFIVIM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1,4-diphenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,4-diphenyltriazole?
The IUPAC name of 5-chloro-1,4-diphenyltriazole (CID 849380) is 5-chloro-1,4-diphenyltriazole.
What is the SMILES notation for 5-chloro-1,4-diphenyltriazole?
The canonical SMILES for 5-chloro-1,4-diphenyltriazole is Clc1c(-c2ccccc2)nnn1-c1ccccc1.
What is the InChIKey of 5-chloro-1,4-diphenyltriazole?
The InChIKey is JROKPQGOVFIVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN3/c15-14-13(11-7-3-1-4-8-11)16-17-18(14)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 5-chloro-1,4-diphenyltriazole?
5-chloro-1,4-diphenyltriazole has a molecular weight of 255.71 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,4-diphenyltriazole is sourced from PubChem (CID 849380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).