About anthracene-9,10-dithiol
anthracene-9,10-dithiol (PubChem CID 849498) has the molecular formula C14H10S2
and a molecular weight of 242.37 g/mol. Its IUPAC name is anthracene-9,10-dithiol.
Molecular Properties
| Compound Name | anthracene-9,10-dithiol |
| PubChem CID | 849498 |
| Molecular Formula | C14H10S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | anthracene-9,10-dithiol |
| SMILES | Sc1c2ccccc2c(S)c2ccccc12 |
| InChI | InChI=1S/C14H10S2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8,15-16H |
| InChIKey | QHWTVIYSEHVEKU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dithiol?
The IUPAC name of anthracene-9,10-dithiol (CID 849498) is anthracene-9,10-dithiol.
What is the SMILES notation for anthracene-9,10-dithiol?
The canonical SMILES for anthracene-9,10-dithiol is Sc1c2ccccc2c(S)c2ccccc12.
What is the InChIKey of anthracene-9,10-dithiol?
The InChIKey is QHWTVIYSEHVEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10S2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8,15-16H.
What are the key properties of anthracene-9,10-dithiol?
anthracene-9,10-dithiol has a molecular weight of 242.37 g/mol, XLogP of 4.57, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dithiol is sourced from PubChem (CID 849498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).