C18H20N2O2 — CID 849706
4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 849706) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 849706 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | Cc1cc2c(n1-c1ccc(C(N)=O)cc1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C18H20N2O2/c1-11-8-14-15(9-18(2,3)10-16(14)21)20(11)13-6-4-12(5-7-13)17(19)22/h4-8H,9-10H2,1-3H3,(H2,19,22) |
| InChIKey | DGGDKWPNFSCGSD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|