C26H25N7O2S — CID 84973053
7-cyano-N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 84973053) has the molecular formula C26H25N7O2S and a molecular weight of 499.60 g/mol. Its IUPAC name is 7-cyano-N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 7-cyano-N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 84973053 |
| Molecular Formula | C26H25N7O2S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 7-cyano-N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CN(C)[C@H]1CCc2nc(NC(=O)c3cccc(CNC(=O)c4cn5ccc(C#N)cc5n4)c3)sc2C1 |
| InChI | InChI=1S/C26H25N7O2S/c1-32(2)19-6-7-20-22(12-19)36-26(30-20)31-24(34)18-5-3-4-17(10-18)14-28-25(35)21-15-33-9-8-16(13-27)11-23(33)29-21/h3-5,8-11,15,19H,6-7,12,14H2,1-2H3,(H,28,35)(H,30,31,34)/t19-/m0/s1 |
| InChIKey | SMTUGKANBCZJAW-IBGZPJMESA-N |
| XLogP | 3.26 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |