C26H26N6O2S2 — CID 84973057
N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 84973057) has the molecular formula C26H26N6O2S2 and a molecular weight of 518.67 g/mol. Its IUPAC name is N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84973057 |
| Molecular Formula | C26H26N6O2S2 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-[[3-[[(6S)-6-(dimethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)[C@H]1CCc2nc(NC(=O)c3cccc(CNC(=O)c4csc(-c5cccnc5)n4)c3)sc2C1 |
| InChI | InChI=1S/C26H26N6O2S2/c1-32(2)19-8-9-20-22(12-19)36-26(30-20)31-23(33)17-6-3-5-16(11-17)13-28-24(34)21-15-35-25(29-21)18-7-4-10-27-14-18/h3-7,10-11,14-15,19H,8-9,12-13H2,1-2H3,(H,28,34)(H,30,31,33)/t19-/m0/s1 |
| InChIKey | IEZRMRUVKSRCGD-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |