C28H28N6O3S2 — CID 84973069
N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 84973069) has the molecular formula C28H28N6O3S2 and a molecular weight of 560.71 g/mol. Its IUPAC name is N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84973069 |
| Molecular Formula | C28H28N6O3S2 |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)C[C@@H](N1CCOCC1)CC2)c1cccc(CNC(=O)c2csc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C28H28N6O3S2/c35-25(33-28-32-22-7-6-21(14-24(22)39-28)34-9-11-37-12-10-34)19-4-1-3-18(13-19)15-30-26(36)23-17-38-27(31-23)20-5-2-8-29-16-20/h1-5,8,13,16-17,21H,6-7,9-12,14-15H2,(H,30,36)(H,32,33,35)/t21-/m0/s1 |
| InChIKey | SVAQNYXFGPPYCL-NRFANRHFSA-N |
| XLogP | 4.03 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |