C29H30N6O3S2 — CID 84973077
4-methyl-N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 84973077) has the molecular formula C29H30N6O3S2 and a molecular weight of 574.73 g/mol. Its IUPAC name is 4-methyl-N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-4-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 84973077 |
| Molecular Formula | C29H30N6O3S2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 4-methyl-N-[[3-[[(6S)-6-morpholin-4-yl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]carbamoyl]phenyl]methyl]-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccncc2)sc1C(=O)NCc1cccc(C(=O)Nc2nc3c(s2)C[C@@H](N2CCOCC2)CC3)c1 |
| InChI | InChI=1S/C29H30N6O3S2/c1-18-25(40-28(32-18)20-7-9-30-10-8-20)27(37)31-17-19-3-2-4-21(15-19)26(36)34-29-33-23-6-5-22(16-24(23)39-29)35-11-13-38-14-12-35/h2-4,7-10,15,22H,5-6,11-14,16-17H2,1H3,(H,31,37)(H,33,34,36)/t22-/m0/s1 |
| InChIKey | HHQRKZASUPOCDG-QFIPXVFZSA-N |
| XLogP | 4.34 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |