About 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol
1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol (PubChem CID 84977192) has the molecular formula C19H21N3O3
and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol |
| PubChem CID | 84977192 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol |
| SMILES | COc1cc2nc(-c3ccccc3)nc(NCC(C)O)c2cc1OC |
| InChI | InChI=1S/C19H21N3O3/c1-12(23)11-20-19-14-9-16(24-2)17(25-3)10-15(14)21-18(22-19)13-7-5-4-6-8-13/h4-10,12,23H,11H2,1-3H3,(H,20,21,22) |
| InChIKey | XEDKGQPAEQODGM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol?
The IUPAC name of 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol (CID 84977192) is 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol.
What is the SMILES notation for 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol?
The canonical SMILES for 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol is COc1cc2nc(-c3ccccc3)nc(NCC(C)O)c2cc1OC.
What is the InChIKey of 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol?
The InChIKey is XEDKGQPAEQODGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3/c1-12(23)11-20-19-14-9-16(24-2)17(25-3)10-15(14)21-18(22-19)13-7-5-4-6-8-13/h4-10,12,23H,11H2,1-3H3,(H,20,21,22).
What are the key properties of 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol?
1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol has a molecular weight of 339.40 g/mol, XLogP of 3.11, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6,7-dimethoxy-2-phenylquinazolin-4-yl)amino]propan-2-ol is sourced from PubChem (CID 84977192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).