About 2-methoxy-5-phenyl-1,3,4-thiadiazole
2-methoxy-5-phenyl-1,3,4-thiadiazole (PubChem CID 849918) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-methoxy-5-phenyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-methoxy-5-phenyl-1,3,4-thiadiazole |
| PubChem CID | 849918 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-methoxy-5-phenyl-1,3,4-thiadiazole |
| SMILES | COc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C9H8N2OS/c1-12-9-11-10-8(13-9)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | OAVVUIBFTBNHOH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-5-phenyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-phenyl-1,3,4-thiadiazole?
The IUPAC name of 2-methoxy-5-phenyl-1,3,4-thiadiazole (CID 849918) is 2-methoxy-5-phenyl-1,3,4-thiadiazole.
What is the SMILES notation for 2-methoxy-5-phenyl-1,3,4-thiadiazole?
The canonical SMILES for 2-methoxy-5-phenyl-1,3,4-thiadiazole is COc1nnc(-c2ccccc2)s1.
What is the InChIKey of 2-methoxy-5-phenyl-1,3,4-thiadiazole?
The InChIKey is OAVVUIBFTBNHOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c1-12-9-11-10-8(13-9)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of 2-methoxy-5-phenyl-1,3,4-thiadiazole?
2-methoxy-5-phenyl-1,3,4-thiadiazole has a molecular weight of 192.24 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-phenyl-1,3,4-thiadiazole is sourced from PubChem (CID 849918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).