C17H19N3O4 — CID 84993401
N-[1-(1-benzofuran-2-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 84993401) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 84993401 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CC(NC(=O)CCCN1C(=O)CNC1=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H19N3O4/c1-11(14-9-12-5-2-3-6-13(12)24-14)19-15(21)7-4-8-20-16(22)10-18-17(20)23/h2-3,5-6,9,11H,4,7-8,10H2,1H3,(H,18,23)(H,19,21) |
| InChIKey | FUWPUHOZAINOPO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|