C18H23N3O4S — CID 84993885
N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-oxoquinazolin-3-yl)acetamide (PubChem CID 84993885) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 84993885 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-oxoquinazolin-3-yl)acetamide |
| SMILES | CCCCN(C(=O)Cn1cnc2ccccc2c1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H23N3O4S/c1-2-3-9-21(14-8-10-26(24,25)12-14)17(22)11-20-13-19-16-7-5-4-6-15(16)18(20)23/h4-7,13-14H,2-3,8-12H2,1H3 |
| InChIKey | DFFOYFDHNHEBKX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |