C15H23FN2O2S — CID 850001
4-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide (PubChem CID 850001) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 850001 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-fluoro-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)c2ccc(F)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C15H23FN2O2S/c1-14(2)9-12(10-15(3,4)18-14)17-21(19,20)13-7-5-11(16)6-8-13/h5-8,12,17-18H,9-10H2,1-4H3 |
| InChIKey | USVMHFMJFLWQMJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |