C20H23NO — CID 85007437
N-(2-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 85007437) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(2-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-(2-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 85007437 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-(2-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC(CNC(=O)c1ccc2c(c1)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C20H23NO/c1-15(16-7-3-2-4-8-16)14-21-20(22)19-12-11-17-9-5-6-10-18(17)13-19/h2-4,7-8,11-13,15H,5-6,9-10,14H2,1H3,(H,21,22) |
| InChIKey | MOBKNHNEKPWGDL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |